C18H20F3N5O4S — CID 155512226
2-[4-[(2E)-2-ethoxyiminopropyl]piperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one (PubChem CID 155512226) has the molecular formula C18H20F3N5O4S and a molecular weight of 459.45 g/mol. Its IUPAC name is 2-[4-[(2E)-2-ethoxyiminopropyl]piperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one.
| Compound Name | 2-[4-[(2E)-2-ethoxyiminopropyl]piperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 155512226 |
| Molecular Formula | C18H20F3N5O4S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 2-[4-[(2E)-2-ethoxyiminopropyl]piperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
| SMILES | CCO/N=C(\C)CN1CCN(c2nc(=O)c3cc(C(F)(F)F)cc([N+](=O)[O-])c3s2)CC1 |
| InChI | InChI=1S/C18H20F3N5O4S/c1-3-30-23-11(2)10-24-4-6-25(7-5-24)17-22-16(27)13-8-12(18(19,20)21)9-14(26(28)29)15(13)31-17/h8-9H,3-7,10H2,1-2H3/b23-11+ |
| InChIKey | NKSJEKHLPIHGFL-FOKLQQMPSA-N |
| XLogP | 3.12 |
| TPSA | 101.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|