C13H12N4O5S — CID 72700337
6,8-dinitro-2-piperidin-1-yl-1,3-benzothiazin-4-one (PubChem CID 72700337) has the molecular formula C13H12N4O5S and a molecular weight of 336.33 g/mol. Its IUPAC name is 6,8-dinitro-2-piperidin-1-yl-1,3-benzothiazin-4-one.
| Compound Name | 6,8-dinitro-2-piperidin-1-yl-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 72700337 |
| Molecular Formula | C13H12N4O5S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 6,8-dinitro-2-piperidin-1-yl-1,3-benzothiazin-4-one |
| SMILES | O=c1nc(N2CCCCC2)sc2c([N+](=O)[O-])cc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C13H12N4O5S/c18-12-9-6-8(16(19)20)7-10(17(21)22)11(9)23-13(14-12)15-4-2-1-3-5-15/h6-7H,1-5H2 |
| InChIKey | ZONFBXZXCZUZHV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 119.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|