C19H26N4O5S2 — CID 166635201
6-methylsulfonyl-8-nitro-2-(4-pentyl-1,4-diazepan-1-yl)-1,3-benzothiazin-4-one (PubChem CID 166635201) has the molecular formula C19H26N4O5S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 6-methylsulfonyl-8-nitro-2-(4-pentyl-1,4-diazepan-1-yl)-1,3-benzothiazin-4-one.
| Compound Name | 6-methylsulfonyl-8-nitro-2-(4-pentyl-1,4-diazepan-1-yl)-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 166635201 |
| Molecular Formula | C19H26N4O5S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 6-methylsulfonyl-8-nitro-2-(4-pentyl-1,4-diazepan-1-yl)-1,3-benzothiazin-4-one |
| SMILES | CCCCCN1CCCN(c2nc(=O)c3cc(S(C)(=O)=O)cc([N+](=O)[O-])c3s2)CC1 |
| InChI | InChI=1S/C19H26N4O5S2/c1-3-4-5-7-21-8-6-9-22(11-10-21)19-20-18(24)15-12-14(30(2,27)28)13-16(23(25)26)17(15)29-19/h12-13H,3-11H2,1-2H3 |
| InChIKey | ZOLJXAGVBUGTKB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|