C20H18N4O6S2 — CID 166625825
2-(4-benzoylpiperazin-1-yl)-6-methylsulfonyl-8-nitro-1,3-benzothiazin-4-one (PubChem CID 166625825) has the molecular formula C20H18N4O6S2 and a molecular weight of 474.52 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-yl)-6-methylsulfonyl-8-nitro-1,3-benzothiazin-4-one.
| Compound Name | 2-(4-benzoylpiperazin-1-yl)-6-methylsulfonyl-8-nitro-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 166625825 |
| Molecular Formula | C20H18N4O6S2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-yl)-6-methylsulfonyl-8-nitro-1,3-benzothiazin-4-one |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c2sc(N3CCN(C(=O)c4ccccc4)CC3)nc(=O)c2c1 |
| InChI | InChI=1S/C20H18N4O6S2/c1-32(29,30)14-11-15-17(16(12-14)24(27)28)31-20(21-18(15)25)23-9-7-22(8-10-23)19(26)13-5-3-2-4-6-13/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | VSIRGGFZYBRQJS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 130.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|