C20H25F3N4O5S2 — CID 169441351
2-(4-heptylsulfonylpiperazin-1-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one (PubChem CID 169441351) has the molecular formula C20H25F3N4O5S2 and a molecular weight of 522.57 g/mol. Its IUPAC name is 2-(4-heptylsulfonylpiperazin-1-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one.
| Compound Name | 2-(4-heptylsulfonylpiperazin-1-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 169441351 |
| Molecular Formula | C20H25F3N4O5S2 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 2-(4-heptylsulfonylpiperazin-1-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
| SMILES | CCCCCCCS(=O)(=O)N1CCN(c2nc(=O)c3cc(C(F)(F)F)cc([N+](=O)[O-])c3s2)CC1 |
| InChI | InChI=1S/C20H25F3N4O5S2/c1-2-3-4-5-6-11-34(31,32)26-9-7-25(8-10-26)19-24-18(28)15-12-14(20(21,22)23)13-16(27(29)30)17(15)33-19/h12-13H,2-11H2,1H3 |
| InChIKey | GVGNASXJDNYWTE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|