C19H13F3N4O4S — CID 163934929
8-nitro-2-[(1R)-3-oxo-2,10-diazatricyclo[6.3.1.02,7]dodeca-4,6-dien-10-yl]-6-(trifluoromethyl)-1,3-benzothiazin-4-one (PubChem CID 163934929) has the molecular formula C19H13F3N4O4S and a molecular weight of 450.40 g/mol. Its IUPAC name is 8-nitro-2-[(1R)-3-oxo-2,10-diazatricyclo[6.3.1.02,7]dodeca-4,6-dien-10-yl]-6-(trifluoromethyl)-1,3-benzothiazin-4-one.
| Compound Name | 8-nitro-2-[(1R)-3-oxo-2,10-diazatricyclo[6.3.1.02,7]dodeca-4,6-dien-10-yl]-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 163934929 |
| Molecular Formula | C19H13F3N4O4S |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 8-nitro-2-[(1R)-3-oxo-2,10-diazatricyclo[6.3.1.02,7]dodeca-4,6-dien-10-yl]-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
| SMILES | O=c1nc(N2CC3C[C@H](C2)n2c3cccc2=O)sc2c([N+](=O)[O-])cc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C19H13F3N4O4S/c20-19(21,22)10-5-12-16(14(6-10)26(29)30)31-18(23-17(12)28)24-7-9-4-11(8-24)25-13(9)2-1-3-15(25)27/h1-3,5-6,9,11H,4,7-8H2/t9?,11-/m1/s1 |
| InChIKey | RLWURTJROGUKFR-HCCKASOXSA-N |
| XLogP | 3.29 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|