C17H20F3N5O3S — CID 164618618
2-[4-(2-methylpropylamino)piperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one (PubChem CID 164618618) has the molecular formula C17H20F3N5O3S and a molecular weight of 431.44 g/mol. Its IUPAC name is 2-[4-(2-methylpropylamino)piperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one.
| Compound Name | 2-[4-(2-methylpropylamino)piperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 164618618 |
| Molecular Formula | C17H20F3N5O3S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-[4-(2-methylpropylamino)piperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
| SMILES | CC(C)CNN1CCN(c2nc(=O)c3cc(C(F)(F)F)cc([N+](=O)[O-])c3s2)CC1 |
| InChI | InChI=1S/C17H20F3N5O3S/c1-10(2)9-21-24-5-3-23(4-6-24)16-22-15(26)12-7-11(17(18,19)20)8-13(25(27)28)14(12)29-16/h7-8,10,21H,3-6,9H2,1-2H3 |
| InChIKey | ADLIYHVVIYIZDD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|