C17H19N3O5S — CID 165100894
5-deuterio-6-methyl-2-(3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-8-nitro-1,3-benzothiazin-4-one (PubChem CID 165100894) has the molecular formula C17H19N3O5S and a molecular weight of 378.43 g/mol. Its IUPAC name is 5-deuterio-6-methyl-2-(3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-8-nitro-1,3-benzothiazin-4-one.
| Compound Name | 5-deuterio-6-methyl-2-(3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-8-nitro-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 165100894 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 5-deuterio-6-methyl-2-(3-methyl-1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-8-nitro-1,3-benzothiazin-4-one |
| SMILES | [2H]c1c(C)cc([N+](=O)[O-])c2sc(N3CCC4(CC3)OCC(C)O4)nc(=O)c12 |
| InChI | InChI=1S/C17H19N3O5S/c1-10-7-12-14(13(8-10)20(22)23)26-16(18-15(12)21)19-5-3-17(4-6-19)24-9-11(2)25-17/h7-8,11H,3-6,9H2,1-2H3/i7D |
| InChIKey | UOVNVAXXXVZUEU-WHRKIXHSSA-N |
| XLogP | 2.60 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|