C17H17F3N3O6S- — CID 123483409
CID 123483409 (PubChem CID 123483409) has the molecular formula C17H17F3N3O6S- and a molecular weight of 448.40 g/mol.
| Compound Name | CID 123483409 |
|---|---|
| PubChem CID | 123483409 |
| Molecular Formula | C17H17F3N3O6S- |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | — |
| SMILES | C[C@H]1COC2(CCN(C3=NC(=O)C4C=C(C(F)(F)F)C=C([N+](=O)[O-])C4=[S-]3=O)CC2)O1 |
| InChI | InChI=1S/C17H17F3N3O6S/c1-9-8-28-16(29-9)2-4-22(5-3-16)15-21-14(24)11-6-10(17(18,19)20)7-12(23(25)26)13(11)30(15)27/h6-7,9,11H,2-5,8H2,1H3/q-1/t9-,11?/m0/s1 |
| InChIKey | SIXMBRCOXSPDRJ-FTNKSUMCSA-N |
| XLogP | 1.53 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|