C25H30F3N3O5S — CID 164621820
[4-[[4-[8-nitro-4-oxo-6-(trifluoromethyl)thiochromen-2-yl]piperazin-1-yl]methyl]cyclohexyl] 2-methylpropanoate (PubChem CID 164621820) has the molecular formula C25H30F3N3O5S and a molecular weight of 541.59 g/mol. Its IUPAC name is [4-[[4-[8-nitro-4-oxo-6-(trifluoromethyl)thiochromen-2-yl]piperazin-1-yl]methyl]cyclohexyl] 2-methylpropanoate.
| Compound Name | [4-[[4-[8-nitro-4-oxo-6-(trifluoromethyl)thiochromen-2-yl]piperazin-1-yl]methyl]cyclohexyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 164621820 |
| Molecular Formula | C25H30F3N3O5S |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | [4-[[4-[8-nitro-4-oxo-6-(trifluoromethyl)thiochromen-2-yl]piperazin-1-yl]methyl]cyclohexyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1CCC(CN2CCN(c3cc(=O)c4cc(C(F)(F)F)cc([N+](=O)[O-])c4s3)CC2)CC1 |
| InChI | InChI=1S/C25H30F3N3O5S/c1-15(2)24(33)36-18-5-3-16(4-6-18)14-29-7-9-30(10-8-29)22-13-21(32)19-11-17(25(26,27)28)12-20(31(34)35)23(19)37-22/h11-13,15-16,18H,3-10,14H2,1-2H3 |
| InChIKey | FEOVTVMRLIUWIA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|