C46H52F6N6O10S2 — CID 175514088
(Z)-but-2-enedioic acid;bis(2-[4-(cyclohexylmethyl)piperazin-1-yl]-8-nitro-6-(trifluoromethyl)thiochromen-4-one) (PubChem CID 175514088) has the molecular formula C46H52F6N6O10S2 and a molecular weight of 1027.08 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;bis(2-[4-(cyclohexylmethyl)piperazin-1-yl]-8-nitro-6-(trifluoromethyl)thiochromen-4-one).
| Compound Name | (Z)-but-2-enedioic acid;bis(2-[4-(cyclohexylmethyl)piperazin-1-yl]-8-nitro-6-(trifluoromethyl)thiochromen-4-one) |
|---|---|
| PubChem CID | 175514088 |
| Molecular Formula | C46H52F6N6O10S2 |
| Molecular Weight | 1027.08 g/mol |
| Exact Mass | 1026.31 |
| IUPAC Name | (Z)-but-2-enedioic acid;bis(2-[4-(cyclohexylmethyl)piperazin-1-yl]-8-nitro-6-(trifluoromethyl)thiochromen-4-one) |
| SMILES | O=C(O)/C=C\C(=O)O.O=c1cc(N2CCN(CC3CCCCC3)CC2)sc2c([N+](=O)[O-])cc(C(F)(F)F)cc12.O=c1cc(N2CCN(CC3CCCCC3)CC2)sc2c([N+](=O)[O-])cc(C(F)(F)F)cc12 |
| InChI | InChI=1S/2C21H24F3N3O3S.C4H4O4/c2*22-21(23,24)15-10-16-18(28)12-19(31-20(16)17(11-15)27(29)30)26-8-6-25(7-9-26)13-14-4-2-1-3-5-14;5-3(6)1-2-4(7)8/h2*10-12,14H,1-9,13H2;1-2H,(H,5,6)(H,7,8)/b;;2-1- |
| InChIKey | PVPIVHQUEQCQQS-KSBRXOFISA-N |
| XLogP | 9.49 |
| TPSA | 207.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.08 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|