C16H14Cl2N4O2 — CID 163236140
6,7-dichloro-4-(4-methyl-2-propan-2-yl-3-pyridinyl)-1H-pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 163236140) has the molecular formula C16H14Cl2N4O2 and a molecular weight of 365.22 g/mol. Its IUPAC name is 6,7-dichloro-4-(4-methyl-2-propan-2-yl-3-pyridinyl)-1H-pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 6,7-dichloro-4-(4-methyl-2-propan-2-yl-3-pyridinyl)-1H-pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 163236140 |
| Molecular Formula | C16H14Cl2N4O2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 6,7-dichloro-4-(4-methyl-2-propan-2-yl-3-pyridinyl)-1H-pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | Cc1ccnc(C(C)C)c1-n1c(=O)c(=O)[nH]c2cc(Cl)c(Cl)nc21 |
| InChI | InChI=1S/C16H14Cl2N4O2/c1-7(2)11-12(8(3)4-5-19-11)22-14-10(20-15(23)16(22)24)6-9(17)13(18)21-14/h4-7H,1-3H3,(H,20,23) |
| InChIKey | IFTZJUPNNHMIMP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|