C16H14ClFN4O3 — CID 167376865
7-chloro-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-8-oxidopyrido[2,3-d]pyrimidin-8-ium-2,4-dione (PubChem CID 167376865) has the molecular formula C16H14ClFN4O3 and a molecular weight of 364.76 g/mol. Its IUPAC name is 7-chloro-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-8-oxidopyrido[2,3-d]pyrimidin-8-ium-2,4-dione.
| Compound Name | 7-chloro-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-8-oxidopyrido[2,3-d]pyrimidin-8-ium-2,4-dione |
|---|---|
| PubChem CID | 167376865 |
| Molecular Formula | C16H14ClFN4O3 |
| Molecular Weight | 364.76 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 7-chloro-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-8-oxidopyrido[2,3-d]pyrimidin-8-ium-2,4-dione |
| SMILES | Cc1ccnc(C(C)C)c1-n1c(=O)[nH]c(=O)c2cc(F)c(Cl)[n+]([O-])c21 |
| InChI | InChI=1S/C16H14ClFN4O3/c1-7(2)11-12(8(3)4-5-19-11)21-15-9(14(23)20-16(21)24)6-10(18)13(17)22(15)25/h4-7H,1-3H3,(H,20,23,24) |
| InChIKey | SDCQCRLFPHIOQF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.76 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|