C19H17BrClFN2O4S — CID 163560177
7-bromo-6-chloro-8-fluoro-4-hydroxy-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-methylsulfonylquinolin-2-one (PubChem CID 163560177) has the molecular formula C19H17BrClFN2O4S and a molecular weight of 503.78 g/mol. Its IUPAC name is 7-bromo-6-chloro-8-fluoro-4-hydroxy-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-methylsulfonylquinolin-2-one.
| Compound Name | 7-bromo-6-chloro-8-fluoro-4-hydroxy-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-methylsulfonylquinolin-2-one |
|---|---|
| PubChem CID | 163560177 |
| Molecular Formula | C19H17BrClFN2O4S |
| Molecular Weight | 503.78 g/mol |
| Exact Mass | 501.98 |
| IUPAC Name | 7-bromo-6-chloro-8-fluoro-4-hydroxy-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-methylsulfonylquinolin-2-one |
| SMILES | Cc1ccnc(C(C)C)c1-n1c(=O)c(S(C)(=O)=O)c(O)c2cc(Cl)c(Br)c(F)c21 |
| InChI | InChI=1S/C19H17BrClFN2O4S/c1-8(2)14-15(9(3)5-6-23-14)24-16-10(7-11(21)12(20)13(16)22)17(25)18(19(24)26)29(4,27)28/h5-8,25H,1-4H3 |
| InChIKey | FQOMWWLSILBAQT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|