C36H35ClFN5O4S — CID 167318020
7-(3-aminonaphthalen-1-yl)-6-chloro-8-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-methylsulfonyl-4-(4-prop-2-enoylpiperazin-1-yl)quinolin-2-one (PubChem CID 167318020) has the molecular formula C36H35ClFN5O4S and a molecular weight of 688.23 g/mol. Its IUPAC name is 7-(3-aminonaphthalen-1-yl)-6-chloro-8-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-methylsulfonyl-4-(4-prop-2-enoylpiperazin-1-yl)quinolin-2-one.
| Compound Name | 7-(3-aminonaphthalen-1-yl)-6-chloro-8-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-methylsulfonyl-4-(4-prop-2-enoylpiperazin-1-yl)quinolin-2-one |
|---|---|
| PubChem CID | 167318020 |
| Molecular Formula | C36H35ClFN5O4S |
| Molecular Weight | 688.23 g/mol |
| Exact Mass | 687.21 |
| IUPAC Name | 7-(3-aminonaphthalen-1-yl)-6-chloro-8-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-methylsulfonyl-4-(4-prop-2-enoylpiperazin-1-yl)quinolin-2-one |
| SMILES | C=CC(=O)N1CCN(c2c(S(C)(=O)=O)c(=O)n(-c3c(C)ccnc3C(C)C)c3c(F)c(-c4cc(N)cc5ccccc45)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C36H35ClFN5O4S/c1-6-28(44)41-13-15-42(16-14-41)34-26-19-27(37)29(25-18-23(39)17-22-9-7-8-10-24(22)25)30(38)33(26)43(36(45)35(34)48(5,46)47)32-21(4)11-12-40-31(32)20(2)3/h6-12,17-20H,1,13-16,39H2,2-5H3 |
| InChIKey | OLMNDRKQPPFIRJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.23 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|