C18H18ClFN4O2 — CID 163245006
1-(2-butan-2-yl-4,6-dimethyl-3-pyridinyl)-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 163245006) has the molecular formula C18H18ClFN4O2 and a molecular weight of 376.82 g/mol. Its IUPAC name is 1-(2-butan-2-yl-4,6-dimethyl-3-pyridinyl)-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-(2-butan-2-yl-4,6-dimethyl-3-pyridinyl)-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163245006 |
| Molecular Formula | C18H18ClFN4O2 |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-(2-butan-2-yl-4,6-dimethyl-3-pyridinyl)-7-chloro-6-fluoropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCC(C)c1nc(C)cc(C)c1-n1c(=O)[nH]c(=O)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C18H18ClFN4O2/c1-5-8(2)13-14(9(3)6-10(4)21-13)24-16-11(17(25)23-18(24)26)7-12(20)15(19)22-16/h6-8H,5H2,1-4H3,(H,23,25,26) |
| InChIKey | OFLLYQAWDGEWCE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|