C20H19ClFN3O4 — CID 165046294
4-[2-(7-chloro-6-fluoro-2,4-dioxopyrido[2,3-d]pyrimidin-1-yl)-3-propan-2-ylphenyl]butanoic acid (PubChem CID 165046294) has the molecular formula C20H19ClFN3O4 and a molecular weight of 419.84 g/mol. Its IUPAC name is 4-[2-(7-chloro-6-fluoro-2,4-dioxopyrido[2,3-d]pyrimidin-1-yl)-3-propan-2-ylphenyl]butanoic acid.
| Compound Name | 4-[2-(7-chloro-6-fluoro-2,4-dioxopyrido[2,3-d]pyrimidin-1-yl)-3-propan-2-ylphenyl]butanoic acid |
|---|---|
| PubChem CID | 165046294 |
| Molecular Formula | C20H19ClFN3O4 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 4-[2-(7-chloro-6-fluoro-2,4-dioxopyrido[2,3-d]pyrimidin-1-yl)-3-propan-2-ylphenyl]butanoic acid |
| SMILES | CC(C)c1cccc(CCCC(=O)O)c1-n1c(=O)[nH]c(=O)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C20H19ClFN3O4/c1-10(2)12-7-3-5-11(6-4-8-15(26)27)16(12)25-18-13(19(28)24-20(25)29)9-14(22)17(21)23-18/h3,5,7,9-10H,4,6,8H2,1-2H3,(H,26,27)(H,24,28,29) |
| InChIKey | OYIRPHDANDBNAE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|