C18H11ClFN3O2 — CID 167088494
7-chloro-6-fluoro-1-(2-methylnaphthalen-1-yl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 167088494) has the molecular formula C18H11ClFN3O2 and a molecular weight of 355.76 g/mol. Its IUPAC name is 7-chloro-6-fluoro-1-(2-methylnaphthalen-1-yl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 7-chloro-6-fluoro-1-(2-methylnaphthalen-1-yl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 167088494 |
| Molecular Formula | C18H11ClFN3O2 |
| Molecular Weight | 355.76 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 7-chloro-6-fluoro-1-(2-methylnaphthalen-1-yl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1ccc2ccccc2c1-n1c(=O)[nH]c(=O)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C18H11ClFN3O2/c1-9-6-7-10-4-2-3-5-11(10)14(9)23-16-12(17(24)22-18(23)25)8-13(20)15(19)21-16/h2-8H,1H3,(H,22,24,25) |
| InChIKey | COZZYRSZWNZRLA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.76 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|