C15H9Cl2F3N4O — CID 156697785
4,7-dichloro-1-[2-(1,1-difluoroethyl)-4-methyl-3-pyridinyl]-6-fluoropyrido[2,3-d]pyrimidin-2-one (PubChem CID 156697785) has the molecular formula C15H9Cl2F3N4O and a molecular weight of 389.16 g/mol. Its IUPAC name is 4,7-dichloro-1-[2-(1,1-difluoroethyl)-4-methyl-3-pyridinyl]-6-fluoropyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4,7-dichloro-1-[2-(1,1-difluoroethyl)-4-methyl-3-pyridinyl]-6-fluoropyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 156697785 |
| Molecular Formula | C15H9Cl2F3N4O |
| Molecular Weight | 389.16 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 4,7-dichloro-1-[2-(1,1-difluoroethyl)-4-methyl-3-pyridinyl]-6-fluoropyrido[2,3-d]pyrimidin-2-one |
| SMILES | Cc1ccnc(C(C)(F)F)c1-n1c(=O)nc(Cl)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C15H9Cl2F3N4O/c1-6-3-4-21-10(15(2,19)20)9(6)24-13-7(11(16)23-14(24)25)5-8(18)12(17)22-13/h3-5H,1-2H3 |
| InChIKey | FQPZAEXBFZCPSG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.16 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|