C22H18BClF2N4O2PS — CID 163976320
CID 163976320 (PubChem CID 163976320) has the molecular formula C22H18BClF2N4O2PS and a molecular weight of 520.73 g/mol.
| Compound Name | CID 163976320 |
|---|---|
| PubChem CID | 163976320 |
| Molecular Formula | C22H18BClF2N4O2PS |
| Molecular Weight | 520.73 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | — |
| SMILES | [2H][B]P=S=O.[3H]c1cccc(F)c1-c1nc2c(cc1F)c(Cl)nc(=O)n2-c1c(C)ccnc1C(C)C |
| InChI | InChI=1S/C22H17ClF2N4O.BHOPS/c1-11(2)17-19(12(3)8-9-26-17)29-21-14(20(23)28-22(29)30)10-16(25)18(27-21)13-6-4-5-7-15(13)24;1-3-4-2/h4-11H,1-3H3;1H/i6T;1D |
| InChIKey | SAMQSZRCXHCYLE-ZMIFXIRFSA-N |
| XLogP | 5.08 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|