C15H10Cl2FN3O2 — CID 167088612
4,7-dichloro-6-fluoro-1-(2-methoxy-6-methylphenyl)pyrido[2,3-d]pyrimidin-2-one (PubChem CID 167088612) has the molecular formula C15H10Cl2FN3O2 and a molecular weight of 354.17 g/mol. Its IUPAC name is 4,7-dichloro-6-fluoro-1-(2-methoxy-6-methylphenyl)pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4,7-dichloro-6-fluoro-1-(2-methoxy-6-methylphenyl)pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 167088612 |
| Molecular Formula | C15H10Cl2FN3O2 |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 4,7-dichloro-6-fluoro-1-(2-methoxy-6-methylphenyl)pyrido[2,3-d]pyrimidin-2-one |
| SMILES | COc1cccc(C)c1-n1c(=O)nc(Cl)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C15H10Cl2FN3O2/c1-7-4-3-5-10(23-2)11(7)21-14-8(12(16)20-15(21)22)6-9(18)13(17)19-14/h3-6H,1-2H3 |
| InChIKey | LGLYDUIJEAEUMP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|