C16H12BrClFN3O — CID 176913565
3-bromo-7-chloro-6-fluoro-4-(methylamino)-1-(2-methylphenyl)-1,8-naphthyridin-2-one (PubChem CID 176913565) has the molecular formula C16H12BrClFN3O and a molecular weight of 396.65 g/mol. Its IUPAC name is 3-bromo-7-chloro-6-fluoro-4-(methylamino)-1-(2-methylphenyl)-1,8-naphthyridin-2-one.
| Compound Name | 3-bromo-7-chloro-6-fluoro-4-(methylamino)-1-(2-methylphenyl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 176913565 |
| Molecular Formula | C16H12BrClFN3O |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | 3-bromo-7-chloro-6-fluoro-4-(methylamino)-1-(2-methylphenyl)-1,8-naphthyridin-2-one |
| SMILES | CNc1c(Br)c(=O)n(-c2ccccc2C)c2nc(Cl)c(F)cc12 |
| InChI | InChI=1S/C16H12BrClFN3O/c1-8-5-3-4-6-11(8)22-15-9(7-10(19)14(18)21-15)13(20-2)12(17)16(22)23/h3-7,20H,1-2H3 |
| InChIKey | IEPQKZSTAWLIRZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|