C23H18ClFN6O — CID 176913623
7-chloro-6-fluoro-4-(methylamino)-3-(2-methylindazol-5-yl)-1-(2-methyl-3-pyridinyl)-1,8-naphthyridin-2-one (PubChem CID 176913623) has the molecular formula C23H18ClFN6O and a molecular weight of 448.89 g/mol. Its IUPAC name is 7-chloro-6-fluoro-4-(methylamino)-3-(2-methylindazol-5-yl)-1-(2-methyl-3-pyridinyl)-1,8-naphthyridin-2-one.
| Compound Name | 7-chloro-6-fluoro-4-(methylamino)-3-(2-methylindazol-5-yl)-1-(2-methyl-3-pyridinyl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 176913623 |
| Molecular Formula | C23H18ClFN6O |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 7-chloro-6-fluoro-4-(methylamino)-3-(2-methylindazol-5-yl)-1-(2-methyl-3-pyridinyl)-1,8-naphthyridin-2-one |
| SMILES | CNc1c(-c2ccc3nn(C)cc3c2)c(=O)n(-c2cccnc2C)c2nc(Cl)c(F)cc12 |
| InChI | InChI=1S/C23H18ClFN6O/c1-12-18(5-4-8-27-12)31-22-15(10-16(25)21(24)28-22)20(26-2)19(23(31)32)13-6-7-17-14(9-13)11-30(3)29-17/h4-11,26H,1-3H3 |
| InChIKey | KYWMCDJQWSAESO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|