C17H12ClFN2O2 — CID 101205316
8-acetyl-2-chloro-3-fluoro-7-methyl-6-phenyl-1,6-naphthyridin-5-one (PubChem CID 101205316) has the molecular formula C17H12ClFN2O2 and a molecular weight of 330.75 g/mol. Its IUPAC name is 8-acetyl-2-chloro-3-fluoro-7-methyl-6-phenyl-1,6-naphthyridin-5-one.
| Compound Name | 8-acetyl-2-chloro-3-fluoro-7-methyl-6-phenyl-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 101205316 |
| Molecular Formula | C17H12ClFN2O2 |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 8-acetyl-2-chloro-3-fluoro-7-methyl-6-phenyl-1,6-naphthyridin-5-one |
| SMILES | CC(=O)c1c(C)n(-c2ccccc2)c(=O)c2cc(F)c(Cl)nc12 |
| InChI | InChI=1S/C17H12ClFN2O2/c1-9-14(10(2)22)15-12(8-13(19)16(18)20-15)17(23)21(9)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| InChIKey | LOTXLKKVYSRJQH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|