C21H22ClN3O2S — CID 29461068
7-chloro-3-(2-methylphenyl)-2-(2-morpholin-4-ylethylsulfanyl)quinazolin-4-one (PubChem CID 29461068) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is 7-chloro-3-(2-methylphenyl)-2-(2-morpholin-4-ylethylsulfanyl)quinazolin-4-one.
| Compound Name | 7-chloro-3-(2-methylphenyl)-2-(2-morpholin-4-ylethylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 29461068 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 7-chloro-3-(2-methylphenyl)-2-(2-morpholin-4-ylethylsulfanyl)quinazolin-4-one |
| SMILES | Cc1ccccc1-n1c(SCCN2CCOCC2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H22ClN3O2S/c1-15-4-2-3-5-19(15)25-20(26)17-7-6-16(22)14-18(17)23-21(25)28-13-10-24-8-11-27-12-9-24/h2-7,14H,8-13H2,1H3 |
| InChIKey | SOAMPYLBSDKAKT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |