C23H22FNO3 — CID 10156574
4-[4-fluoro-2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoic acid (PubChem CID 10156574) has the molecular formula C23H22FNO3 and a molecular weight of 379.43 g/mol. Its IUPAC name is 4-[4-fluoro-2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoic acid.
| Compound Name | 4-[4-fluoro-2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoic acid |
|---|---|
| PubChem CID | 10156574 |
| Molecular Formula | C23H22FNO3 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-[4-fluoro-2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoic acid |
| SMILES | CC(C(=O)Nc1cc(F)ccc1CCCC(=O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H22FNO3/c1-15(19-10-4-7-16-6-2-3-9-20(16)19)23(28)25-21-14-18(24)13-12-17(21)8-5-11-22(26)27/h2-4,6-7,9-10,12-15H,5,8,11H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | VOHVCNYTILFPJF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |