C25H23NO2 — CID 142116711
N-[5-ethynyl-2-(4-oxobutyl)phenyl]-2-naphthalen-1-ylpropanamide (PubChem CID 142116711) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is N-[5-ethynyl-2-(4-oxobutyl)phenyl]-2-naphthalen-1-ylpropanamide.
| Compound Name | N-[5-ethynyl-2-(4-oxobutyl)phenyl]-2-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 142116711 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-[5-ethynyl-2-(4-oxobutyl)phenyl]-2-naphthalen-1-ylpropanamide |
| SMILES | C#Cc1ccc(CCCC=O)c(NC(=O)C(C)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C25H23NO2/c1-3-19-14-15-21(10-6-7-16-27)24(17-19)26-25(28)18(2)22-13-8-11-20-9-4-5-12-23(20)22/h1,4-5,8-9,11-18H,6-7,10H2,2H3,(H,26,28) |
| InChIKey | CDRYRWWYNNOYPT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|