C30H33N3O4 — CID 20747681
[2-(diethylamino)-2-oxoethyl] 4-[4-isocyano-2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoate (PubChem CID 20747681) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 4-[4-isocyano-2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] 4-[4-isocyano-2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoate |
|---|---|
| PubChem CID | 20747681 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 4-[4-isocyano-2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoate |
| SMILES | [C-]#[N+]c1ccc(CCCC(=O)OCC(=O)N(CC)CC)c(NC(=O)C(C)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C30H33N3O4/c1-5-33(6-2)28(34)20-37-29(35)16-10-13-23-17-18-24(31-4)19-27(23)32-30(36)21(3)25-15-9-12-22-11-7-8-14-26(22)25/h7-9,11-12,14-15,17-19,21H,5-6,10,13,16,20H2,1-3H3,(H,32,36) |
| InChIKey | YINZZNJWAXBTHL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|