C25H29NO3 — CID 91562881
ethane;4-[2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoic acid (PubChem CID 91562881) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is ethane;4-[2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoic acid.
| Compound Name | ethane;4-[2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoic acid |
|---|---|
| PubChem CID | 91562881 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | ethane;4-[2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoic acid |
| SMILES | CC.CC(C(=O)Nc1ccccc1CCCC(=O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H23NO3.C2H6/c1-16(19-13-6-10-17-8-2-4-12-20(17)19)23(27)24-21-14-5-3-9-18(21)11-7-15-22(25)26;1-2/h2-6,8-10,12-14,16H,7,11,15H2,1H3,(H,24,27)(H,25,26);1-2H3 |
| InChIKey | KWRWYXCFODPRMX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |