C30H29NO4S — CID 23017572
4-[4-(benzenesulfinylmethyl)-2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoic acid (PubChem CID 23017572) has the molecular formula C30H29NO4S and a molecular weight of 499.63 g/mol. Its IUPAC name is 4-[4-(benzenesulfinylmethyl)-2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoic acid.
| Compound Name | 4-[4-(benzenesulfinylmethyl)-2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoic acid |
|---|---|
| PubChem CID | 23017572 |
| Molecular Formula | C30H29NO4S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 4-[4-(benzenesulfinylmethyl)-2-(2-naphthalen-1-ylpropanoylamino)phenyl]butanoic acid |
| SMILES | CC(C(=O)Nc1cc(CS(=O)c2ccccc2)ccc1CCCC(=O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H29NO4S/c1-21(26-15-7-10-23-9-5-6-14-27(23)26)30(34)31-28-19-22(17-18-24(28)11-8-16-29(32)33)20-36(35)25-12-3-2-4-13-25/h2-7,9-10,12-15,17-19,21H,8,11,16,20H2,1H3,(H,31,34)(H,32,33) |
| InChIKey | QUAWYSNCZZPEDQ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |