C34H30ClNO2 — CID 141063789
N-[2-benzyl-5-[(2-chloro-5-methylphenoxy)methyl]phenyl]-2-naphthalen-1-ylpropanamide (PubChem CID 141063789) has the molecular formula C34H30ClNO2 and a molecular weight of 520.07 g/mol. Its IUPAC name is N-[2-benzyl-5-[(2-chloro-5-methylphenoxy)methyl]phenyl]-2-naphthalen-1-ylpropanamide.
| Compound Name | N-[2-benzyl-5-[(2-chloro-5-methylphenoxy)methyl]phenyl]-2-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 141063789 |
| Molecular Formula | C34H30ClNO2 |
| Molecular Weight | 520.07 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | N-[2-benzyl-5-[(2-chloro-5-methylphenoxy)methyl]phenyl]-2-naphthalen-1-ylpropanamide |
| SMILES | Cc1ccc(Cl)c(OCc2ccc(Cc3ccccc3)c(NC(=O)C(C)c3cccc4ccccc34)c2)c1 |
| InChI | InChI=1S/C34H30ClNO2/c1-23-15-18-31(35)33(19-23)38-22-26-16-17-28(20-25-9-4-3-5-10-25)32(21-26)36-34(37)24(2)29-14-8-12-27-11-6-7-13-30(27)29/h3-19,21,24H,20,22H2,1-2H3,(H,36,37) |
| InChIKey | BMCOXIKGXCBSPO-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.07 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |