C30H29NO4 — CID 174458881
4-[4-[[2-(2-naphthalen-1-ylpropanoylamino)phenyl]methoxy]phenyl]butanoic acid (PubChem CID 174458881) has the molecular formula C30H29NO4 and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-[4-[[2-(2-naphthalen-1-ylpropanoylamino)phenyl]methoxy]phenyl]butanoic acid.
| Compound Name | 4-[4-[[2-(2-naphthalen-1-ylpropanoylamino)phenyl]methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 174458881 |
| Molecular Formula | C30H29NO4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 4-[4-[[2-(2-naphthalen-1-ylpropanoylamino)phenyl]methoxy]phenyl]butanoic acid |
| SMILES | CC(C(=O)Nc1ccccc1COc1ccc(CCCC(=O)O)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H29NO4/c1-21(26-13-7-11-23-9-2-4-12-27(23)26)30(34)31-28-14-5-3-10-24(28)20-35-25-18-16-22(17-19-25)8-6-15-29(32)33/h2-5,7,9-14,16-19,21H,6,8,15,20H2,1H3,(H,31,34)(H,32,33) |
| InChIKey | BQHCOALIJCMRDA-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |