C26H26N2O3 — CID 20747663
3-[4-isocyano-2-[(4-methyl-2-naphthalen-1-ylpentanoyl)amino]phenyl]propanoic acid (PubChem CID 20747663) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-[4-isocyano-2-[(4-methyl-2-naphthalen-1-ylpentanoyl)amino]phenyl]propanoic acid.
| Compound Name | 3-[4-isocyano-2-[(4-methyl-2-naphthalen-1-ylpentanoyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 20747663 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-[4-isocyano-2-[(4-methyl-2-naphthalen-1-ylpentanoyl)amino]phenyl]propanoic acid |
| SMILES | [C-]#[N+]c1ccc(CCC(=O)O)c(NC(=O)C(CC(C)C)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C26H26N2O3/c1-17(2)15-23(22-10-6-8-18-7-4-5-9-21(18)22)26(31)28-24-16-20(27-3)13-11-19(24)12-14-25(29)30/h4-11,13,16-17,23H,12,14-15H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | QAULLSQMPCMVRE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 70.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|