C28H25NO4 — CID 23017411
3-[2-(1-naphthalen-1-ylethylcarbamoyl)-4-phenoxyphenyl]propanoic acid (PubChem CID 23017411) has the molecular formula C28H25NO4 and a molecular weight of 439.51 g/mol. Its IUPAC name is 3-[2-(1-naphthalen-1-ylethylcarbamoyl)-4-phenoxyphenyl]propanoic acid.
| Compound Name | 3-[2-(1-naphthalen-1-ylethylcarbamoyl)-4-phenoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 23017411 |
| Molecular Formula | C28H25NO4 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-[2-(1-naphthalen-1-ylethylcarbamoyl)-4-phenoxyphenyl]propanoic acid |
| SMILES | CC(NC(=O)c1cc(Oc2ccccc2)ccc1CCC(=O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H25NO4/c1-19(24-13-7-9-20-8-5-6-12-25(20)24)29-28(32)26-18-23(33-22-10-3-2-4-11-22)16-14-21(26)15-17-27(30)31/h2-14,16,18-19H,15,17H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | NHGWCLKIVFBVFP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |