C29H24F5NO2 — CID 142214069
2-butyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-(2,3,4,5,6-pentafluorophenoxy)benzamide (PubChem CID 142214069) has the molecular formula C29H24F5NO2 and a molecular weight of 513.51 g/mol. Its IUPAC name is 2-butyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-(2,3,4,5,6-pentafluorophenoxy)benzamide.
| Compound Name | 2-butyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-(2,3,4,5,6-pentafluorophenoxy)benzamide |
|---|---|
| PubChem CID | 142214069 |
| Molecular Formula | C29H24F5NO2 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 2-butyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-(2,3,4,5,6-pentafluorophenoxy)benzamide |
| SMILES | CCCCc1ccc(Oc2c(F)c(F)c(F)c(F)c2F)cc1C(=O)N[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H24F5NO2/c1-3-4-8-18-13-14-19(37-28-26(33)24(31)23(30)25(32)27(28)34)15-22(18)29(36)35-16(2)20-12-7-10-17-9-5-6-11-21(17)20/h5-7,9-16H,3-4,8H2,1-2H3,(H,35,36)/t16-/m1/s1 |
| InChIKey | XUJAMLBWXAPFSW-MRXNPFEDSA-N |
| XLogP | 8.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|