C30H27N3O3 — CID 10344965
4-[4-(3-cyanoanilino)-2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]phenyl]butanoic acid (PubChem CID 10344965) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4-[4-(3-cyanoanilino)-2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]phenyl]butanoic acid.
| Compound Name | 4-[4-(3-cyanoanilino)-2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 10344965 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 4-[4-(3-cyanoanilino)-2-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]phenyl]butanoic acid |
| SMILES | C[C@@H](NC(=O)c1cc(Nc2cccc(C#N)c2)ccc1CCCC(=O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H27N3O3/c1-20(26-13-5-9-22-8-2-3-12-27(22)26)32-30(36)28-18-25(16-15-23(28)10-6-14-29(34)35)33-24-11-4-7-21(17-24)19-31/h2-5,7-9,11-13,15-18,20,33H,6,10,14H2,1H3,(H,32,36)(H,34,35)/t20-/m1/s1 |
| InChIKey | ZPCTWPISNWMESA-HXUWFJFHSA-N |
| XLogP | 6.35 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |