C14H11Cl2N5O2 — CID 146254500
6,7-dichloro-1-(4-propan-2-ylpyrimidin-5-yl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 146254500) has the molecular formula C14H11Cl2N5O2 and a molecular weight of 352.18 g/mol. Its IUPAC name is 6,7-dichloro-1-(4-propan-2-ylpyrimidin-5-yl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6,7-dichloro-1-(4-propan-2-ylpyrimidin-5-yl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 146254500 |
| Molecular Formula | C14H11Cl2N5O2 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 6,7-dichloro-1-(4-propan-2-ylpyrimidin-5-yl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC(C)c1ncncc1-n1c(=O)[nH]c(=O)c2cc(Cl)c(Cl)nc21 |
| InChI | InChI=1S/C14H11Cl2N5O2/c1-6(2)10-9(4-17-5-18-10)21-12-7(13(22)20-14(21)23)3-8(15)11(16)19-12/h3-6H,1-2H3,(H,20,22,23) |
| InChIKey | ATGHCRHQSLPIIB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|