C18H18Cl2N4O2 — CID 156732178
6,7-dichloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-4-hydroxy-1,8-naphthyridin-2-one (PubChem CID 156732178) has the molecular formula C18H18Cl2N4O2 and a molecular weight of 393.27 g/mol. Its IUPAC name is 6,7-dichloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-4-hydroxy-1,8-naphthyridin-2-one.
| Compound Name | 6,7-dichloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-4-hydroxy-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 156732178 |
| Molecular Formula | C18H18Cl2N4O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 6,7-dichloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-4-hydroxy-1,8-naphthyridin-2-one |
| SMILES | CC(C)c1ncnc(C(C)C)c1-n1c(=O)cc(O)c2cc(Cl)c(Cl)nc21 |
| InChI | InChI=1S/C18H18Cl2N4O2/c1-8(2)14-16(15(9(3)4)22-7-21-14)24-13(26)6-12(25)10-5-11(19)17(20)23-18(10)24/h5-9,25H,1-4H3 |
| InChIKey | XOSHZIDGLMKBHU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|