C20H18Cl2N4O2 — CID 150553078
6,7-dichloro-1-[2,4-di(propan-2-yl)-3-pyridinyl]-4-hydroxy-2-oxo-1,8-naphthyridine-3-carbonitrile (PubChem CID 150553078) has the molecular formula C20H18Cl2N4O2 and a molecular weight of 417.30 g/mol. Its IUPAC name is 6,7-dichloro-1-[2,4-di(propan-2-yl)-3-pyridinyl]-4-hydroxy-2-oxo-1,8-naphthyridine-3-carbonitrile.
| Compound Name | 6,7-dichloro-1-[2,4-di(propan-2-yl)-3-pyridinyl]-4-hydroxy-2-oxo-1,8-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 150553078 |
| Molecular Formula | C20H18Cl2N4O2 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 6,7-dichloro-1-[2,4-di(propan-2-yl)-3-pyridinyl]-4-hydroxy-2-oxo-1,8-naphthyridine-3-carbonitrile |
| SMILES | CC(C)c1ccnc(C(C)C)c1-n1c(=O)c(C#N)c(O)c2cc(Cl)c(Cl)nc21 |
| InChI | InChI=1S/C20H18Cl2N4O2/c1-9(2)11-5-6-24-15(10(3)4)16(11)26-19-12(7-14(21)18(22)25-19)17(27)13(8-23)20(26)28/h5-7,9-10,27H,1-4H3 |
| InChIKey | IIGXCGUDMWUASB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|