C25H26F3N4O+ — CID 163236264
(E)-1-[(2R)-2-[(3aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-3-ium-4-yl]methanimine (PubChem CID 163236264) has the molecular formula C25H26F3N4O+ and a molecular weight of 455.50 g/mol. Its IUPAC name is (E)-1-[(2R)-2-[(3aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-3-ium-4-yl]methanimine.
| Compound Name | (E)-1-[(2R)-2-[(3aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-3-ium-4-yl]methanimine |
|---|---|
| PubChem CID | 163236264 |
| Molecular Formula | C25H26F3N4O+ |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (E)-1-[(2R)-2-[(3aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-N-[6-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-3-ium-4-yl]methanimine |
| SMILES | FC(F)(F)c1cc2c(/N=C/C3c4ccccc4CC[C@@H]3C3CC4COC[C@H]4C3)[nH+]cnc2[nH]1 |
| InChI | InChI=1S/C25H25F3N4O/c26-25(27,28)22-9-20-23(30-13-31-24(20)32-22)29-10-21-18-4-2-1-3-14(18)5-6-19(21)15-7-16-11-33-12-17(16)8-15/h1-4,9-10,13,15-17,19,21H,5-8,11-12H2,(H,30,31,32)/p+1/b29-10+/t15?,16-,17?,19-,21?/m1/s1 |
| InChIKey | ROQHEIGFICJFBA-PFMUCYHYSA-O |
| XLogP | 5.12 |
| TPSA | 64.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|