C34H24N2O10S — CID 163236456
N-(3-methoxyphenyl)-5-[2-[(3-methoxyphenyl)carbamoyl]-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoindene-2-carboxamide (PubChem CID 163236456) has the molecular formula C34H24N2O10S and a molecular weight of 652.64 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-5-[2-[(3-methoxyphenyl)carbamoyl]-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoindene-2-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-5-[2-[(3-methoxyphenyl)carbamoyl]-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoindene-2-carboxamide |
|---|---|
| PubChem CID | 163236456 |
| Molecular Formula | C34H24N2O10S |
| Molecular Weight | 652.64 g/mol |
| Exact Mass | 652.12 |
| IUPAC Name | N-(3-methoxyphenyl)-5-[2-[(3-methoxyphenyl)carbamoyl]-1,3-dioxoinden-5-yl]sulfonyl-1,3-dioxoindene-2-carboxamide |
| SMILES | COc1cccc(NC(=O)C2C(=O)c3ccc(S(=O)(=O)c4ccc5c(c4)C(=O)C(C(=O)Nc4cccc(OC)c4)C5=O)cc3C2=O)c1 |
| InChI | InChI=1S/C34H24N2O10S/c1-45-19-7-3-5-17(13-19)35-33(41)27-29(37)23-11-9-21(15-25(23)31(27)39)47(43,44)22-10-12-24-26(16-22)32(40)28(30(24)38)34(42)36-18-6-4-8-20(14-18)46-2/h3-16,27-28H,1-2H3,(H,35,41)(H,36,42) |
| InChIKey | VHBMWFLYPLAPRK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 179.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|