C24H26F4N5O3+ — CID 163237748
(E)-[(2E)-3-[1-[1-[[5-(2,4-difluorophenoxy)pyrazin-2-yl]amino]-1-oxopropan-2-yl]-4,4-difluoropiperidin-3-yl]penta-2,4-dienylidene]-methoxyazanium (PubChem CID 163237748) has the molecular formula C24H26F4N5O3+ and a molecular weight of 508.50 g/mol. Its IUPAC name is (E)-[(2E)-3-[1-[1-[[5-(2,4-difluorophenoxy)pyrazin-2-yl]amino]-1-oxopropan-2-yl]-4,4-difluoropiperidin-3-yl]penta-2,4-dienylidene]-methoxyazanium.
| Compound Name | (E)-[(2E)-3-[1-[1-[[5-(2,4-difluorophenoxy)pyrazin-2-yl]amino]-1-oxopropan-2-yl]-4,4-difluoropiperidin-3-yl]penta-2,4-dienylidene]-methoxyazanium |
|---|---|
| PubChem CID | 163237748 |
| Molecular Formula | C24H26F4N5O3+ |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (E)-[(2E)-3-[1-[1-[[5-(2,4-difluorophenoxy)pyrazin-2-yl]amino]-1-oxopropan-2-yl]-4,4-difluoropiperidin-3-yl]penta-2,4-dienylidene]-methoxyazanium |
| SMILES | C=C/C(=C\C=[NH+]\OC)C1CN(C(C)C(=O)Nc2cnc(Oc3ccc(F)cc3F)cn2)CCC1(F)F |
| InChI | InChI=1S/C24H25F4N5O3/c1-4-16(7-9-31-35-3)18-14-33(10-8-24(18,27)28)15(2)23(34)32-21-12-30-22(13-29-21)36-20-6-5-17(25)11-19(20)26/h4-7,9,11-13,15,18H,1,8,10,14H2,2-3H3,(H,29,32,34)/p+1/b16-7+,31-9+ |
| InChIKey | XIQUKHPGGWLUOK-KSXKUZBGSA-O |
| XLogP | 2.66 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|