C10H12F2N2O — CID 163237925
5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one (PubChem CID 163237925) has the molecular formula C10H12F2N2O and a molecular weight of 214.21 g/mol. Its IUPAC name is 5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one.
| Compound Name | 5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 163237925 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 5-(4,4-difluoropiperidin-3-yl)-1H-pyridin-2-one |
| SMILES | O=c1ccc(C2CNCCC2(F)F)c[nH]1 |
| InChI | InChI=1S/C10H12F2N2O/c11-10(12)3-4-13-6-8(10)7-1-2-9(15)14-5-7/h1-2,5,8,13H,3-4,6H2,(H,14,15) |
| InChIKey | HDGMGUOLBMDQRI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |