C9H13N5O2 — CID 163241387
2-N,4-N-diethyl-1,3,5-triazine-2,4-dicarboxamide (PubChem CID 163241387) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 2-N,4-N-diethyl-1,3,5-triazine-2,4-dicarboxamide.
| Compound Name | 2-N,4-N-diethyl-1,3,5-triazine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 163241387 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-N,4-N-diethyl-1,3,5-triazine-2,4-dicarboxamide |
| SMILES | CCNC(=O)c1ncnc(C(=O)NCC)n1 |
| InChI | InChI=1S/C9H13N5O2/c1-3-10-8(15)6-12-5-13-7(14-6)9(16)11-4-2/h5H,3-4H2,1-2H3,(H,10,15)(H,11,16) |
| InChIKey | HMHBMZZILVPLQM-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |