C14H20N2O2S — CID 163242161
5,6-dimethyl-N-(4-methyl-1-oxothian-4-yl)pyridine-3-carboxamide (PubChem CID 163242161) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 5,6-dimethyl-N-(4-methyl-1-oxothian-4-yl)pyridine-3-carboxamide.
| Compound Name | 5,6-dimethyl-N-(4-methyl-1-oxothian-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163242161 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 5,6-dimethyl-N-(4-methyl-1-oxothian-4-yl)pyridine-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2(C)CCS(=O)CC2)cnc1C |
| InChI | InChI=1S/C14H20N2O2S/c1-10-8-12(9-15-11(10)2)13(17)16-14(3)4-6-19(18)7-5-14/h8-9H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | XVDJQXLVTRPANC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |