C22H23ClF3N5O4S — CID 171553169
6-[[5-chloro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-5,7-dimethyl-N-(4-methyl-1-oxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide (PubChem CID 171553169) has the molecular formula C22H23ClF3N5O4S and a molecular weight of 545.97 g/mol. Its IUPAC name is 6-[[5-chloro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-5,7-dimethyl-N-(4-methyl-1-oxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide.
| Compound Name | 6-[[5-chloro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-5,7-dimethyl-N-(4-methyl-1-oxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171553169 |
| Molecular Formula | C22H23ClF3N5O4S |
| Molecular Weight | 545.97 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | 6-[[5-chloro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-5,7-dimethyl-N-(4-methyl-1-oxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
| SMILES | Cc1cc2nc(C(=O)NC3(C)CCS(=O)CC3)nn2c(C)c1Oc1ncc(Cl)cc1OCC(F)(F)F |
| InChI | InChI=1S/C22H23ClF3N5O4S/c1-12-8-16-28-18(19(32)29-21(3)4-6-36(33)7-5-21)30-31(16)13(2)17(12)35-20-15(9-14(23)10-27-20)34-11-22(24,25)26/h8-10H,4-7,11H2,1-3H3,(H,29,32) |
| InChIKey | NEJGVLLUYVCBGR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.97 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |