C17H14ClF3N4O4 — CID 171553122
methyl 6-[[5-chloro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylate (PubChem CID 171553122) has the molecular formula C17H14ClF3N4O4 and a molecular weight of 430.77 g/mol. Its IUPAC name is methyl 6-[[5-chloro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylate.
| Compound Name | methyl 6-[[5-chloro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 171553122 |
| Molecular Formula | C17H14ClF3N4O4 |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | methyl 6-[[5-chloro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc2cc(C)c(Oc3ncc(Cl)cc3OCC(F)(F)F)c(C)n2n1 |
| InChI | InChI=1S/C17H14ClF3N4O4/c1-8-4-12-23-14(16(26)27-3)24-25(12)9(2)13(8)29-15-11(5-10(18)6-22-15)28-7-17(19,20)21/h4-6H,7H2,1-3H3 |
| InChIKey | OXAXEYIPZXEPNW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 87.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |