C24H25ClF5N5O4S — CID 171553116
6-[[5-chloro-3-(2,2-difluoropropoxy)-2-pyridinyl]oxy]-5-methyl-N-[1-methylidene-1-oxo-4-(2,2,2-trifluoroethyl)thian-4-yl]-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide (PubChem CID 171553116) has the molecular formula C24H25ClF5N5O4S and a molecular weight of 610.01 g/mol. Its IUPAC name is 6-[[5-chloro-3-(2,2-difluoropropoxy)-2-pyridinyl]oxy]-5-methyl-N-[1-methylidene-1-oxo-4-(2,2,2-trifluoroethyl)thian-4-yl]-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide.
| Compound Name | 6-[[5-chloro-3-(2,2-difluoropropoxy)-2-pyridinyl]oxy]-5-methyl-N-[1-methylidene-1-oxo-4-(2,2,2-trifluoroethyl)thian-4-yl]-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171553116 |
| Molecular Formula | C24H25ClF5N5O4S |
| Molecular Weight | 610.01 g/mol |
| Exact Mass | 609.12 |
| IUPAC Name | 6-[[5-chloro-3-(2,2-difluoropropoxy)-2-pyridinyl]oxy]-5-methyl-N-[1-methylidene-1-oxo-4-(2,2,2-trifluoroethyl)thian-4-yl]-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
| SMILES | C=S1(=O)CCC(CC(F)(F)F)(NC(=O)c2nc3ccc(Oc4ncc(Cl)cc4OCC(C)(F)F)c(C)n3n2)CC1 |
| InChI | InChI=1S/C24H25ClF5N5O4S/c1-14-16(39-21-17(10-15(25)11-31-21)38-13-22(2,26)27)4-5-18-32-19(34-35(14)18)20(36)33-23(12-24(28,29)30)6-8-40(3,37)9-7-23/h4-5,10-11H,3,6-9,12-13H2,1-2H3,(H,33,36) |
| InChIKey | ZNCAKYQMFXIOIV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.01 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|