C29H28N4O3S — CID 163242923
(10R)-6-(2,6-dimethylphenyl)-7-(4-methoxyphenyl)-10-methyl-9-oxa-2-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-13-one (PubChem CID 163242923) has the molecular formula C29H28N4O3S and a molecular weight of 512.64 g/mol. Its IUPAC name is (10R)-6-(2,6-dimethylphenyl)-7-(4-methoxyphenyl)-10-methyl-9-oxa-2-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-13-one.
| Compound Name | (10R)-6-(2,6-dimethylphenyl)-7-(4-methoxyphenyl)-10-methyl-9-oxa-2-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-13-one |
|---|---|
| PubChem CID | 163242923 |
| Molecular Formula | C29H28N4O3S |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | (10R)-6-(2,6-dimethylphenyl)-7-(4-methoxyphenyl)-10-methyl-9-oxa-2-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-13-one |
| SMILES | COc1ccc(-c2c3nc(nc2-c2c(C)cccc2C)NSc2cccc(c2)C(=O)NC[C@@H](C)O3)cc1 |
| InChI | InChI=1S/C29H28N4O3S/c1-17-7-5-8-18(2)24(17)26-25(20-11-13-22(35-4)14-12-20)28-32-29(31-26)33-37-23-10-6-9-21(15-23)27(34)30-16-19(3)36-28/h5-15,19H,16H2,1-4H3,(H,30,34)(H,31,32,33)/t19-/m1/s1 |
| InChIKey | ISRRFXKBCAFDBL-LJQANCHMSA-N |
| XLogP | 6.07 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|