C28H33N5O2S — CID 170667288
(16R)-18-butyl-12-(2,6-dimethylphenyl)-15-oxa-8-thia-1,9,11,18,22-pentazatetracyclo[14.4.1.13,7.110,14]tricosa-3(23),4,6,10,12,14(22)-hexaen-2-one (PubChem CID 170667288) has the molecular formula C28H33N5O2S and a molecular weight of 503.67 g/mol. Its IUPAC name is (16R)-18-butyl-12-(2,6-dimethylphenyl)-15-oxa-8-thia-1,9,11,18,22-pentazatetracyclo[14.4.1.13,7.110,14]tricosa-3(23),4,6,10,12,14(22)-hexaen-2-one.
| Compound Name | (16R)-18-butyl-12-(2,6-dimethylphenyl)-15-oxa-8-thia-1,9,11,18,22-pentazatetracyclo[14.4.1.13,7.110,14]tricosa-3(23),4,6,10,12,14(22)-hexaen-2-one |
|---|---|
| PubChem CID | 170667288 |
| Molecular Formula | C28H33N5O2S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | (16R)-18-butyl-12-(2,6-dimethylphenyl)-15-oxa-8-thia-1,9,11,18,22-pentazatetracyclo[14.4.1.13,7.110,14]tricosa-3(23),4,6,10,12,14(22)-hexaen-2-one |
| SMILES | CCCCN1CCN2C[C@@H](C1)Oc1cc(-c3c(C)cccc3C)nc(n1)NSc1cccc(c1)C2=O |
| InChI | InChI=1S/C28H33N5O2S/c1-4-5-12-32-13-14-33-18-22(17-32)35-25-16-24(26-19(2)8-6-9-20(26)3)29-28(30-25)31-36-23-11-7-10-21(15-23)27(33)34/h6-11,15-16,22H,4-5,12-14,17-18H2,1-3H3,(H,29,30,31)/t22-/m1/s1 |
| InChIKey | DTUZQIKXQCGVMO-JOCHJYFZSA-N |
| XLogP | 5.20 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|